C16H22BN2O5 — CID 163960412
CID 163960412 (PubChem CID 163960412) has the molecular formula C16H22BN2O5 and a molecular weight of 333.17 g/mol.
| Compound Name | CID 163960412 |
|---|---|
| PubChem CID | 163960412 |
| Molecular Formula | C16H22BN2O5 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | — |
| SMILES | CC(N)(CO)CN1CC(Oc2ccc3c(c2C(=O)O)O[B]CC3)C1 |
| InChI | InChI=1S/C16H22BN2O5/c1-16(18,9-20)8-19-6-11(7-19)23-12-3-2-10-4-5-17-24-14(10)13(12)15(21)22/h2-3,11,20H,4-9,18H2,1H3,(H,21,22) |
| InChIKey | YCHMRLIGFCRYDI-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|