C22H25BCl2N6O4 — CID 156730761
CID 156730761 (PubChem CID 156730761) has the molecular formula C22H25BCl2N6O4 and a molecular weight of 519.20 g/mol.
| Compound Name | CID 156730761 |
|---|---|
| PubChem CID | 156730761 |
| Molecular Formula | C22H25BCl2N6O4 |
| Molecular Weight | 519.20 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O)n1ncc(Nc2ncc3cc(Cl)c(C4CCN([C@]5(C)COCC5O)CC4)cc3n2)c1Cl |
| InChI | InChI=1S/C22H25BCl2N6O4/c1-21(11-35-10-18(21)32)30-4-2-12(3-5-30)14-7-16-13(6-15(14)24)8-26-20(28-16)29-17-9-27-31(19(17)25)22(23,33)34/h6-9,12,18,32-34H,2-5,10-11H2,1H3,(H,26,28,29)/t18?,21-/m1/s1 |
| InChIKey | DGIMMLWAJBNZQJ-BDPMCISCSA-N |
| XLogP | 1.93 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|