C14H7F11N2O — CID 156732747
1-[2-fluoro-4-(trifluoromethyl)phenyl]-4-(2,2,3,3,4,4,4-heptafluorobutoxy)pyrazole (PubChem CID 156732747) has the molecular formula C14H7F11N2O and a molecular weight of 428.20 g/mol. Its IUPAC name is 1-[2-fluoro-4-(trifluoromethyl)phenyl]-4-(2,2,3,3,4,4,4-heptafluorobutoxy)pyrazole.
| Compound Name | 1-[2-fluoro-4-(trifluoromethyl)phenyl]-4-(2,2,3,3,4,4,4-heptafluorobutoxy)pyrazole |
|---|---|
| PubChem CID | 156732747 |
| Molecular Formula | C14H7F11N2O |
| Molecular Weight | 428.20 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 1-[2-fluoro-4-(trifluoromethyl)phenyl]-4-(2,2,3,3,4,4,4-heptafluorobutoxy)pyrazole |
| SMILES | Fc1cc(C(F)(F)F)ccc1-n1cc(OCC(F)(F)C(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H7F11N2O/c15-9-3-7(12(18,19)20)1-2-10(9)27-5-8(4-26-27)28-6-11(16,17)13(21,22)14(23,24)25/h1-5H,6H2 |
| InChIKey | ZUMNTLQBIXAKQS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.20 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|