C15H12F7N7OS — CID 156732767
4-ethylsulfanyl-3-[4-(2,2,3,3,4,4,4-heptafluorobutoxy)pyrazol-1-yl]-6-(1,2,4-triazol-1-yl)pyridazine (PubChem CID 156732767) has the molecular formula C15H12F7N7OS and a molecular weight of 471.36 g/mol. Its IUPAC name is 4-ethylsulfanyl-3-[4-(2,2,3,3,4,4,4-heptafluorobutoxy)pyrazol-1-yl]-6-(1,2,4-triazol-1-yl)pyridazine.
| Compound Name | 4-ethylsulfanyl-3-[4-(2,2,3,3,4,4,4-heptafluorobutoxy)pyrazol-1-yl]-6-(1,2,4-triazol-1-yl)pyridazine |
|---|---|
| PubChem CID | 156732767 |
| Molecular Formula | C15H12F7N7OS |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 4-ethylsulfanyl-3-[4-(2,2,3,3,4,4,4-heptafluorobutoxy)pyrazol-1-yl]-6-(1,2,4-triazol-1-yl)pyridazine |
| SMILES | CCSc1cc(-n2cncn2)nnc1-n1cc(OCC(F)(F)C(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C15H12F7N7OS/c1-2-31-10-3-11(29-8-23-7-25-29)26-27-12(10)28-5-9(4-24-28)30-6-13(16,17)14(18,19)15(20,21)22/h3-5,7-8H,2,6H2,1H3 |
| InChIKey | MZPNTVZBLBJMFA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|