C22H24NO6+ — CID 156733624
[(2S)-3-[4-(4-methoxy-2-methylidene-4-oxobutanoyl)oxyphenyl]-1-oxo-1-phenylmethoxypropan-2-yl]azanium (PubChem CID 156733624) has the molecular formula C22H24NO6+ and a molecular weight of 398.44 g/mol. Its IUPAC name is [(2S)-3-[4-(4-methoxy-2-methylidene-4-oxobutanoyl)oxyphenyl]-1-oxo-1-phenylmethoxypropan-2-yl]azanium.
| Compound Name | [(2S)-3-[4-(4-methoxy-2-methylidene-4-oxobutanoyl)oxyphenyl]-1-oxo-1-phenylmethoxypropan-2-yl]azanium |
|---|---|
| PubChem CID | 156733624 |
| Molecular Formula | C22H24NO6+ |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | [(2S)-3-[4-(4-methoxy-2-methylidene-4-oxobutanoyl)oxyphenyl]-1-oxo-1-phenylmethoxypropan-2-yl]azanium |
| SMILES | C=C(CC(=O)OC)C(=O)Oc1ccc(C[C@H]([NH3+])C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO6/c1-15(12-20(24)27-2)21(25)29-18-10-8-16(9-11-18)13-19(23)22(26)28-14-17-6-4-3-5-7-17/h3-11,19H,1,12-14,23H2,2H3/p+1/t19-/m0/s1 |
| InChIKey | XMOQDIALXFNRPR-IBGZPJMESA-O |
| XLogP | 1.61 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|