C16H20N2O5 — CID 156733640
1-O-[4-[2-amino-3-(methylamino)-3-oxopropyl]phenyl] 4-O-methyl 2-methylidenebutanedioate (PubChem CID 156733640) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-O-[4-[2-amino-3-(methylamino)-3-oxopropyl]phenyl] 4-O-methyl 2-methylidenebutanedioate.
| Compound Name | 1-O-[4-[2-amino-3-(methylamino)-3-oxopropyl]phenyl] 4-O-methyl 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 156733640 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-O-[4-[2-amino-3-(methylamino)-3-oxopropyl]phenyl] 4-O-methyl 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC)C(=O)Oc1ccc(CC(N)C(=O)NC)cc1 |
| InChI | InChI=1S/C16H20N2O5/c1-10(8-14(19)22-3)16(21)23-12-6-4-11(5-7-12)9-13(17)15(20)18-2/h4-7,13H,1,8-9,17H2,2-3H3,(H,18,20) |
| InChIKey | JDMUNSCZGJWYJI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|