C14H25N3O — CID 156737847
N-[(1Z)-buta-1,3-dienyl]-N-(3-methyl-1,3-diazinan-4-yl)prop-2-enamide;ethane (PubChem CID 156737847) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is N-[(1Z)-buta-1,3-dienyl]-N-(3-methyl-1,3-diazinan-4-yl)prop-2-enamide;ethane.
| Compound Name | N-[(1Z)-buta-1,3-dienyl]-N-(3-methyl-1,3-diazinan-4-yl)prop-2-enamide;ethane |
|---|---|
| PubChem CID | 156737847 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | N-[(1Z)-buta-1,3-dienyl]-N-(3-methyl-1,3-diazinan-4-yl)prop-2-enamide;ethane |
| SMILES | C=C/C=C\N(C(=O)C=C)C1CCNCN1C.CC |
| InChI | InChI=1S/C12H19N3O.C2H6/c1-4-6-9-15(12(16)5-2)11-7-8-13-10-14(11)3;1-2/h4-6,9,11,13H,1-2,7-8,10H2,3H3;1-2H3/b9-6-; |
| InChIKey | KJYRJLFHJQKFTF-BORNJIKYSA-N |
| XLogP | 1.94 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|