C10H17N3O2 — CID 123583440
N-(3-butan-2-yl-2-oxo-1,6-dihydropyrimidin-6-yl)acetamide (PubChem CID 123583440) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-(3-butan-2-yl-2-oxo-1,6-dihydropyrimidin-6-yl)acetamide.
| Compound Name | N-(3-butan-2-yl-2-oxo-1,6-dihydropyrimidin-6-yl)acetamide |
|---|---|
| PubChem CID | 123583440 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N-(3-butan-2-yl-2-oxo-1,6-dihydropyrimidin-6-yl)acetamide |
| SMILES | CCC(C)N1C=CC(NC(C)=O)NC1=O |
| InChI | InChI=1S/C10H17N3O2/c1-4-7(2)13-6-5-9(11-8(3)14)12-10(13)15/h5-7,9H,4H2,1-3H3,(H,11,14)(H,12,15) |
| InChIKey | MXJLISRTKQICBS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |