C13H23N3O2 — CID 23326872
1-Butyl-6-(ethylamino)-3-propan-2-ylpyrimidine-2,4-dione (PubChem CID 23326872) has the molecular formula C13H23N3O2 and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-butyl-6-(ethylamino)-3-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 1-Butyl-6-(ethylamino)-3-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23326872 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-butyl-6-(ethylamino)-3-propan-2-ylpyrimidine-2,4-dione |
| SMILES | CCCCN1C(=CC(=O)N(C1=O)C(C)C)NCC |
| InChI | InChI=1S/C13H23N3O2/c1-5-7-8-15-11(14-6-2)9-12(17)16(10(3)4)13(15)18/h9-10,14H,5-8H2,1-4H3 |
| InChIKey | OTYIHGFRQXJNGW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | 350 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |