C28H34N4OS — CID 156739206
4-[3-(14-ethyl-5,5-dimethyl-6-oxa-17-thia-2,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11,13,15-hexaen-15-yl)pentyl]benzene-1,2-diamine (PubChem CID 156739206) has the molecular formula C28H34N4OS and a molecular weight of 474.67 g/mol. Its IUPAC name is 4-[3-(14-ethyl-5,5-dimethyl-6-oxa-17-thia-2,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11,13,15-hexaen-15-yl)pentyl]benzene-1,2-diamine.
| Compound Name | 4-[3-(14-ethyl-5,5-dimethyl-6-oxa-17-thia-2,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11,13,15-hexaen-15-yl)pentyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 156739206 |
| Molecular Formula | C28H34N4OS |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 4-[3-(14-ethyl-5,5-dimethyl-6-oxa-17-thia-2,12-diazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11,13,15-hexaen-15-yl)pentyl]benzene-1,2-diamine |
| SMILES | CCc1cnc2c(sc3nc4c(cc32)COC(C)(C)C4)c1C(CC)CCc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C28H34N4OS/c1-5-17(9-7-16-8-10-21(29)22(30)11-16)24-18(6-2)14-31-25-20-12-19-15-33-28(3,4)13-23(19)32-27(20)34-26(24)25/h8,10-12,14,17H,5-7,9,13,15,29-30H2,1-4H3 |
| InChIKey | USBBYDJMUNNHPI-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|