C25H29N3O3S — CID 41010903
6-acetamido-12,12-dimethyl-N-[(2R)-4-phenylbutan-2-yl]-11-oxa-4-thia-2-azatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-5-carboxamide (PubChem CID 41010903) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is 6-acetamido-12,12-dimethyl-N-[(2R)-4-phenylbutan-2-yl]-11-oxa-4-thia-2-azatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-5-carboxamide.
| Compound Name | 6-acetamido-12,12-dimethyl-N-[(2R)-4-phenylbutan-2-yl]-11-oxa-4-thia-2-azatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 41010903 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 6-acetamido-12,12-dimethyl-N-[(2R)-4-phenylbutan-2-yl]-11-oxa-4-thia-2-azatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-5-carboxamide |
| SMILES | CC(=O)Nc1c(C(=O)N[C@H](C)CCc2ccccc2)sc2nc3c(cc12)COC(C)(C)C3 |
| InChI | InChI=1S/C25H29N3O3S/c1-15(10-11-17-8-6-5-7-9-17)26-23(30)22-21(27-16(2)29)19-12-18-14-31-25(3,4)13-20(18)28-24(19)32-22/h5-9,12,15H,10-11,13-14H2,1-4H3,(H,26,30)(H,27,29)/t15-/m1/s1 |
| InChIKey | YVKBPJPTGAGVMY-OAHLLOKOSA-N |
| XLogP | 4.86 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |