About 1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol
1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol (PubChem CID 156741773) has the molecular formula C18H38N2O3
and a molecular weight of 330.51 g/mol. Its IUPAC name is 1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol.
Molecular Properties
| Compound Name | 1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol |
| PubChem CID | 156741773 |
| Molecular Formula | C18H38N2O3 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | 1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol |
| SMILES | CCC(C)C(C)O.CCC(C)C(O)CN1CCN(CC)C(=O)C1 |
| InChI | InChI=1S/C12H24N2O2.C6H14O/c1-4-10(3)11(15)8-13-6-7-14(5-2)12(16)9-13;1-4-5(2)6(3)7/h10-11,15H,4-9H2,1-3H3;5-7H,4H2,1-3H3 |
| InChIKey | XIRKUBNUBJIMGA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol?
The IUPAC name of 1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol (CID 156741773) is 1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol.
What is the SMILES notation for 1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol?
The canonical SMILES for 1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol is CCC(C)C(C)O.CCC(C)C(O)CN1CCN(CC)C(=O)C1.
What is the InChIKey of 1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol?
The InChIKey is XIRKUBNUBJIMGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2.C6H14O/c1-4-10(3)11(15)8-13-6-7-14(5-2)12(16)9-13;1-4-5(2)6(3)7/h10-11,15H,4-9H2,1-3H3;5-7H,4H2,1-3H3.
What are the key properties of 1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol?
1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol has a molecular weight of 330.51 g/mol, XLogP of 1.97, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-(2-hydroxy-3-methylpentyl)piperazin-2-one;3-methylpentan-2-ol is sourced from PubChem (CID 156741773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).