C10H9F3N2S2 — CID 156742112
3-ethylsulfanyl-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-thiol (PubChem CID 156742112) has the molecular formula C10H9F3N2S2 and a molecular weight of 278.32 g/mol. Its IUPAC name is 3-ethylsulfanyl-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-thiol.
| Compound Name | 3-ethylsulfanyl-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-thiol |
|---|---|
| PubChem CID | 156742112 |
| Molecular Formula | C10H9F3N2S2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 3-ethylsulfanyl-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-thiol |
| SMILES | CCSc1c(S)nc2ccc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C10H9F3N2S2/c1-2-17-9-8(16)14-7-4-3-6(5-15(7)9)10(11,12)13/h3-5,16H,2H2,1H3 |
| InChIKey | HJUQLDGEQZQOMJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 17.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|