C17H14BrF3N4OS — CID 170092905
2-amino-N-(6-bromo-3-ethylsulfanylimidazo[1,2-a]pyridin-2-yl)-5-(trifluoromethyl)benzamide (PubChem CID 170092905) has the molecular formula C17H14BrF3N4OS and a molecular weight of 459.29 g/mol. Its IUPAC name is 2-amino-N-(6-bromo-3-ethylsulfanylimidazo[1,2-a]pyridin-2-yl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-(6-bromo-3-ethylsulfanylimidazo[1,2-a]pyridin-2-yl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 170092905 |
| Molecular Formula | C17H14BrF3N4OS |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 2-amino-N-(6-bromo-3-ethylsulfanylimidazo[1,2-a]pyridin-2-yl)-5-(trifluoromethyl)benzamide |
| SMILES | CCSc1c(NC(=O)c2cc(C(F)(F)F)ccc2N)nc2ccc(Br)cn12 |
| InChI | InChI=1S/C17H14BrF3N4OS/c1-2-27-16-14(23-13-6-4-10(18)8-25(13)16)24-15(26)11-7-9(17(19,20)21)3-5-12(11)22/h3-8H,2,22H2,1H3,(H,24,26) |
| InChIKey | YBQXUOYMGCTYFL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|