C16H27NO5S — CID 156742303
but-1-ene;ethane;2-[(4-methylbenzoyl)amino]ethyl hydrogen sulfate (PubChem CID 156742303) has the molecular formula C16H27NO5S and a molecular weight of 345.46 g/mol. Its IUPAC name is but-1-ene;ethane;2-[(4-methylbenzoyl)amino]ethyl hydrogen sulfate.
| Compound Name | but-1-ene;ethane;2-[(4-methylbenzoyl)amino]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 156742303 |
| Molecular Formula | C16H27NO5S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | but-1-ene;ethane;2-[(4-methylbenzoyl)amino]ethyl hydrogen sulfate |
| SMILES | C=CCC.CC.Cc1ccc(C(=O)NCCOS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H13NO5S.C4H8.C2H6/c1-8-2-4-9(5-3-8)10(12)11-6-7-16-17(13,14)15;1-3-4-2;1-2/h2-5H,6-7H2,1H3,(H,11,12)(H,13,14,15);3H,1,4H2,2H3;1-2H3 |
| InChIKey | RKAKPRBZAVISGK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|