C30H48O4 — CID 156743065
(2R,6R)-6-[(3R,4R,7S,10S,13R,17R)-3,4-dihydroxy-4,7,10,13-tetramethyl-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylideneheptanoic acid (PubChem CID 156743065) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is (2R,6R)-6-[(3R,4R,7S,10S,13R,17R)-3,4-dihydroxy-4,7,10,13-tetramethyl-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylideneheptanoic acid.
| Compound Name | (2R,6R)-6-[(3R,4R,7S,10S,13R,17R)-3,4-dihydroxy-4,7,10,13-tetramethyl-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylideneheptanoic acid |
|---|---|
| PubChem CID | 156743065 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | (2R,6R)-6-[(3R,4R,7S,10S,13R,17R)-3,4-dihydroxy-4,7,10,13-tetramethyl-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylideneheptanoic acid |
| SMILES | C=C(CC[C@@H](C)[C@H]1CCC2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@@H](O)[C@](C)(O)C1C[C@@H]3C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C30H48O4/c1-17(20(4)27(32)33)8-9-18(2)21-10-11-22-26-19(3)16-24-29(6,15-13-25(31)30(24,7)34)23(26)12-14-28(21,22)5/h18-22,24-25,31,34H,1,8-16H2,2-7H3,(H,32,33)/t18-,19+,20-,21-,22?,24?,25-,28-,29-,30-/m1/s1 |
| InChIKey | GIAMQBNGSSWHIK-QJAZVHTISA-N |
| XLogP | 6.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|