C30H42O4 — CID 22210251
(6R)-2-methyl-3-methylidene-6-[(10S,13R,14R,17R)-4,10,13-trimethyl-7-methylidene-3,11-dioxo-1,2,4,5,6,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]heptanoic acid (PubChem CID 22210251) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is (6R)-2-methyl-3-methylidene-6-[(10S,13R,14R,17R)-4,10,13-trimethyl-7-methylidene-3,11-dioxo-1,2,4,5,6,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]heptanoic acid.
| Compound Name | (6R)-2-methyl-3-methylidene-6-[(10S,13R,14R,17R)-4,10,13-trimethyl-7-methylidene-3,11-dioxo-1,2,4,5,6,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]heptanoic acid |
|---|---|
| PubChem CID | 22210251 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | (6R)-2-methyl-3-methylidene-6-[(10S,13R,14R,17R)-4,10,13-trimethyl-7-methylidene-3,11-dioxo-1,2,4,5,6,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]heptanoic acid |
| SMILES | C=C1CC2C(C)C(=O)CC[C@]2(C)C2=C1[C@@H]1CC[C@H]([C@H](C)CCC(=C)C(C)C(=O)O)[C@@]1(C)CC2=O |
| InChI | InChI=1S/C30H42O4/c1-16(19(4)28(33)34)8-9-17(2)21-10-11-22-26-18(3)14-23-20(5)24(31)12-13-29(23,6)27(26)25(32)15-30(21,22)7/h17,19-23H,1,3,8-15H2,2,4-7H3,(H,33,34)/t17-,19?,20?,21-,22+,23?,29+,30-/m1/s1 |
| InChIKey | AOHVXUIUIGQIIP-VPGFFCABSA-N |
| XLogP | 6.56 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|