C31H44O5 — CID 163074500
ethyl 2-methyl-3-methylidene-6-(4,10,13-trimethyl-3,7,11-trioxo-1,2,4,5,6,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)heptanoate (PubChem CID 163074500) has the molecular formula C31H44O5 and a molecular weight of 496.69 g/mol. Its IUPAC name is ethyl 2-methyl-3-methylidene-6-(4,10,13-trimethyl-3,7,11-trioxo-1,2,4,5,6,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)heptanoate.
| Compound Name | ethyl 2-methyl-3-methylidene-6-(4,10,13-trimethyl-3,7,11-trioxo-1,2,4,5,6,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)heptanoate |
|---|---|
| PubChem CID | 163074500 |
| Molecular Formula | C31H44O5 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | ethyl 2-methyl-3-methylidene-6-(4,10,13-trimethyl-3,7,11-trioxo-1,2,4,5,6,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)heptanoate |
| SMILES | C=C(CCC(C)C1CCC2C3=C(C(=O)CC21C)C1(C)CCC(=O)C(C)C1CC3=O)C(C)C(=O)OCC |
| InChI | InChI=1S/C31H44O5/c1-8-36-29(35)19(4)17(2)9-10-18(3)21-11-12-22-27-25(33)15-23-20(5)24(32)13-14-30(23,6)28(27)26(34)16-31(21,22)7/h18-23H,2,8-16H2,1,3-7H3 |
| InChIKey | HTYKEMWVKPSKKC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|