C29H40O5 — CID 162857391
(2R,6R)-6-[(4S,5S,7S,10S,13R,17R)-7-hydroxy-4,10,13-trimethyl-3,11-dioxo-2,4,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylideneheptanoic acid (PubChem CID 162857391) has the molecular formula C29H40O5 and a molecular weight of 468.63 g/mol. Its IUPAC name is (2R,6R)-6-[(4S,5S,7S,10S,13R,17R)-7-hydroxy-4,10,13-trimethyl-3,11-dioxo-2,4,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylideneheptanoic acid.
| Compound Name | (2R,6R)-6-[(4S,5S,7S,10S,13R,17R)-7-hydroxy-4,10,13-trimethyl-3,11-dioxo-2,4,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylideneheptanoic acid |
|---|---|
| PubChem CID | 162857391 |
| Molecular Formula | C29H40O5 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | (2R,6R)-6-[(4S,5S,7S,10S,13R,17R)-7-hydroxy-4,10,13-trimethyl-3,11-dioxo-2,4,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylideneheptanoic acid |
| SMILES | C=C(CC[C@@H](C)[C@H]1CC=C2C3=C(C(=O)C[C@@]21C)[C@@]1(C)CCC(=O)[C@@H](C)[C@@H]1C[C@@H]3O)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C29H40O5/c1-15(17(3)27(33)34)7-8-16(2)19-9-10-20-25-23(31)13-21-18(4)22(30)11-12-28(21,5)26(25)24(32)14-29(19,20)6/h10,16-19,21,23,31H,1,7-9,11-14H2,2-6H3,(H,33,34)/t16-,17-,18+,19-,21+,23+,28+,29-/m1/s1 |
| InChIKey | ZPSJWLSADLCKBZ-MNGIRRGESA-N |
| XLogP | 5.29 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|