C19H17ClFNO3S3 — CID 156743656
(4-chlorophenyl)-[2-(2-fluorophenyl)-5-propylsulfonyl-1,3-thiazol-4-yl]-methylidene-oxo-λ6-sulfane (PubChem CID 156743656) has the molecular formula C19H17ClFNO3S3 and a molecular weight of 458.00 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-(2-fluorophenyl)-5-propylsulfonyl-1,3-thiazol-4-yl]-methylidene-oxo-λ6-sulfane.
| Compound Name | (4-chlorophenyl)-[2-(2-fluorophenyl)-5-propylsulfonyl-1,3-thiazol-4-yl]-methylidene-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 156743656 |
| Molecular Formula | C19H17ClFNO3S3 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | (4-chlorophenyl)-[2-(2-fluorophenyl)-5-propylsulfonyl-1,3-thiazol-4-yl]-methylidene-oxo-λ6-sulfane |
| SMILES | C=S(=O)(c1ccc(Cl)cc1)c1nc(-c2ccccc2F)sc1S(=O)(=O)CCC |
| InChI | InChI=1S/C19H17ClFNO3S3/c1-3-12-28(24,25)19-18(27(2,23)14-10-8-13(20)9-11-14)22-17(26-19)15-6-4-5-7-16(15)21/h4-11H,2-3,12H2,1H3 |
| InChIKey | BQKRTLNFDXQPHF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|