C19H18ClFN2O3S — CID 18826859
N-butyl-4-(4-chlorophenyl)sulfonyl-2-(2-fluorophenyl)-1,3-oxazol-5-amine (PubChem CID 18826859) has the molecular formula C19H18ClFN2O3S and a molecular weight of 408.88 g/mol. Its IUPAC name is N-butyl-4-(4-chlorophenyl)sulfonyl-2-(2-fluorophenyl)-1,3-oxazol-5-amine.
| Compound Name | N-butyl-4-(4-chlorophenyl)sulfonyl-2-(2-fluorophenyl)-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 18826859 |
| Molecular Formula | C19H18ClFN2O3S |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-butyl-4-(4-chlorophenyl)sulfonyl-2-(2-fluorophenyl)-1,3-oxazol-5-amine |
| SMILES | CCCCNc1oc(-c2ccccc2F)nc1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClFN2O3S/c1-2-3-12-22-18-19(27(24,25)14-10-8-13(20)9-11-14)23-17(26-18)15-6-4-5-7-16(15)21/h4-11,22H,2-3,12H2,1H3 |
| InChIKey | DZCPMBFJOHUYRA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|