C18H14Cl2N2O3S — CID 18826640
2-(2-chlorophenyl)-4-(4-chlorophenyl)sulfonyl-N-prop-2-enyl-1,3-oxazol-5-amine (PubChem CID 18826640) has the molecular formula C18H14Cl2N2O3S and a molecular weight of 409.29 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-(4-chlorophenyl)sulfonyl-N-prop-2-enyl-1,3-oxazol-5-amine.
| Compound Name | 2-(2-chlorophenyl)-4-(4-chlorophenyl)sulfonyl-N-prop-2-enyl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 18826640 |
| Molecular Formula | C18H14Cl2N2O3S |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 2-(2-chlorophenyl)-4-(4-chlorophenyl)sulfonyl-N-prop-2-enyl-1,3-oxazol-5-amine |
| SMILES | C=CCNc1oc(-c2ccccc2Cl)nc1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14Cl2N2O3S/c1-2-11-21-17-18(26(23,24)13-9-7-12(19)8-10-13)22-16(25-17)14-5-3-4-6-15(14)20/h2-10,21H,1,11H2 |
| InChIKey | XTFSUXSEASMXML-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|