C19H18Cl2N2O4S — CID 18826632
2-(2-chlorophenyl)-4-(4-chlorophenyl)sulfonyl-N-(3-methoxypropyl)-1,3-oxazol-5-amine (PubChem CID 18826632) has the molecular formula C19H18Cl2N2O4S and a molecular weight of 441.34 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-(4-chlorophenyl)sulfonyl-N-(3-methoxypropyl)-1,3-oxazol-5-amine.
| Compound Name | 2-(2-chlorophenyl)-4-(4-chlorophenyl)sulfonyl-N-(3-methoxypropyl)-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 18826632 |
| Molecular Formula | C19H18Cl2N2O4S |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 2-(2-chlorophenyl)-4-(4-chlorophenyl)sulfonyl-N-(3-methoxypropyl)-1,3-oxazol-5-amine |
| SMILES | COCCCNc1oc(-c2ccccc2Cl)nc1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O4S/c1-26-12-4-11-22-18-19(28(24,25)14-9-7-13(20)8-10-14)23-17(27-18)15-5-2-3-6-16(15)21/h2-3,5-10,22H,4,11-12H2,1H3 |
| InChIKey | HMRUEBTYHOCYMB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|