C20H21ClN2O5S — CID 18827102
4-(4-chlorophenyl)sulfonyl-2-(4-methoxyphenyl)-N-(3-methoxypropyl)-1,3-oxazol-5-amine (PubChem CID 18827102) has the molecular formula C20H21ClN2O5S and a molecular weight of 436.92 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-2-(4-methoxyphenyl)-N-(3-methoxypropyl)-1,3-oxazol-5-amine.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-2-(4-methoxyphenyl)-N-(3-methoxypropyl)-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 18827102 |
| Molecular Formula | C20H21ClN2O5S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-2-(4-methoxyphenyl)-N-(3-methoxypropyl)-1,3-oxazol-5-amine |
| SMILES | COCCCNc1oc(-c2ccc(OC)cc2)nc1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O5S/c1-26-13-3-12-22-19-20(29(24,25)17-10-6-15(21)7-11-17)23-18(28-19)14-4-8-16(27-2)9-5-14/h4-11,22H,3,12-13H2,1-2H3 |
| InChIKey | HLLJXTFNHHXEOR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|