C21H25N3O4S — CID 4825674
N-[4-(benzenesulfonyl)-2-(4-methoxyphenyl)-1,3-oxazol-5-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 4825674) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[4-(benzenesulfonyl)-2-(4-methoxyphenyl)-1,3-oxazol-5-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[4-(benzenesulfonyl)-2-(4-methoxyphenyl)-1,3-oxazol-5-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 4825674 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-[4-(benzenesulfonyl)-2-(4-methoxyphenyl)-1,3-oxazol-5-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | COc1ccc(-c2nc(S(=O)(=O)c3ccccc3)c(NCCCN(C)C)o2)cc1 |
| InChI | InChI=1S/C21H25N3O4S/c1-24(2)15-7-14-22-20-21(29(25,26)18-8-5-4-6-9-18)23-19(28-20)16-10-12-17(27-3)13-11-16/h4-6,8-13,22H,7,14-15H2,1-3H3 |
| InChIKey | XULZJBLVDQLJBH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|