C18H18N2O4S — CID 18826955
4-(benzenesulfonyl)-N-ethyl-2-(4-methoxyphenyl)-1,3-oxazol-5-amine (PubChem CID 18826955) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-ethyl-2-(4-methoxyphenyl)-1,3-oxazol-5-amine.
| Compound Name | 4-(benzenesulfonyl)-N-ethyl-2-(4-methoxyphenyl)-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 18826955 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-(benzenesulfonyl)-N-ethyl-2-(4-methoxyphenyl)-1,3-oxazol-5-amine |
| SMILES | CCNc1oc(-c2ccc(OC)cc2)nc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O4S/c1-3-19-17-18(25(21,22)15-7-5-4-6-8-15)20-16(24-17)13-9-11-14(23-2)12-10-13/h4-12,19H,3H2,1-2H3 |
| InChIKey | INLBQMKMGHLHLT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |