C20H20N2O4S — CID 18826076
4-(benzenesulfonyl)-2-(4-ethoxyphenyl)-N-prop-2-enyl-1,3-oxazol-5-amine (PubChem CID 18826076) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2-(4-ethoxyphenyl)-N-prop-2-enyl-1,3-oxazol-5-amine.
| Compound Name | 4-(benzenesulfonyl)-2-(4-ethoxyphenyl)-N-prop-2-enyl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 18826076 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 4-(benzenesulfonyl)-2-(4-ethoxyphenyl)-N-prop-2-enyl-1,3-oxazol-5-amine |
| SMILES | C=CCNc1oc(-c2ccc(OCC)cc2)nc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-3-14-21-19-20(27(23,24)17-8-6-5-7-9-17)22-18(26-19)15-10-12-16(13-11-15)25-4-2/h3,5-13,21H,1,4,14H2,2H3 |
| InChIKey | PQBUXSBVVDLFOJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|