C23H26N2O4S — CID 18826075
4-(benzenesulfonyl)-N-cyclohexyl-2-(4-ethoxyphenyl)-1,3-oxazol-5-amine (PubChem CID 18826075) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-cyclohexyl-2-(4-ethoxyphenyl)-1,3-oxazol-5-amine.
| Compound Name | 4-(benzenesulfonyl)-N-cyclohexyl-2-(4-ethoxyphenyl)-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 18826075 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 4-(benzenesulfonyl)-N-cyclohexyl-2-(4-ethoxyphenyl)-1,3-oxazol-5-amine |
| SMILES | CCOc1ccc(-c2nc(S(=O)(=O)c3ccccc3)c(NC3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C23H26N2O4S/c1-2-28-19-15-13-17(14-16-19)21-25-23(30(26,27)20-11-7-4-8-12-20)22(29-21)24-18-9-5-3-6-10-18/h4,7-8,11-16,18,24H,2-3,5-6,9-10H2,1H3 |
| InChIKey | QAFUOKYHMWOOOH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |