C18H15ClN2O3S — CID 18826525
4-(benzenesulfonyl)-2-(2-chlorophenyl)-N-cyclopropyl-1,3-oxazol-5-amine (PubChem CID 18826525) has the molecular formula C18H15ClN2O3S and a molecular weight of 374.85 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-2-(2-chlorophenyl)-N-cyclopropyl-1,3-oxazol-5-amine.
| Compound Name | 4-(benzenesulfonyl)-2-(2-chlorophenyl)-N-cyclopropyl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 18826525 |
| Molecular Formula | C18H15ClN2O3S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 4-(benzenesulfonyl)-2-(2-chlorophenyl)-N-cyclopropyl-1,3-oxazol-5-amine |
| SMILES | O=S(=O)(c1ccccc1)c1nc(-c2ccccc2Cl)oc1NC1CC1 |
| InChI | InChI=1S/C18H15ClN2O3S/c19-15-9-5-4-8-14(15)16-21-18(17(24-16)20-12-10-11-12)25(22,23)13-6-2-1-3-7-13/h1-9,12,20H,10-11H2 |
| InChIKey | JRGGJLPCRNZVKH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |