C22H28N4 — CID 156743834
N-methyl-4-[2-(5-propan-2-yl-1H-pyrazol-4-yl)quinolin-7-yl]cyclohexan-1-amine (PubChem CID 156743834) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-methyl-4-[2-(5-propan-2-yl-1H-pyrazol-4-yl)quinolin-7-yl]cyclohexan-1-amine.
| Compound Name | N-methyl-4-[2-(5-propan-2-yl-1H-pyrazol-4-yl)quinolin-7-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 156743834 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | N-methyl-4-[2-(5-propan-2-yl-1H-pyrazol-4-yl)quinolin-7-yl]cyclohexan-1-amine |
| SMILES | CNC1CCC(c2ccc3ccc(-c4cn[nH]c4C(C)C)nc3c2)CC1 |
| InChI | InChI=1S/C22H28N4/c1-14(2)22-19(13-24-26-22)20-11-8-16-4-5-17(12-21(16)25-20)15-6-9-18(23-3)10-7-15/h4-5,8,11-15,18,23H,6-7,9-10H2,1-3H3,(H,24,26) |
| InChIKey | OSSDWFZSRKLWDZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |