C15H20N2O2 — CID 174446537
6-[4-(methylamino)cyclohexyl]-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde (PubChem CID 174446537) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 6-[4-(methylamino)cyclohexyl]-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde.
| Compound Name | 6-[4-(methylamino)cyclohexyl]-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde |
|---|---|
| PubChem CID | 174446537 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 6-[4-(methylamino)cyclohexyl]-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde |
| SMILES | CNC1CCC(c2ccc3c(c2)OC(C=O)N3)CC1 |
| InChI | InChI=1S/C15H20N2O2/c1-16-12-5-2-10(3-6-12)11-4-7-13-14(8-11)19-15(9-18)17-13/h4,7-10,12,15-17H,2-3,5-6H2,1H3 |
| InChIKey | TYVKOFCMWOPRMS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|