C18H20BrNO2 — CID 156746181
ethyl 4-bromo-3-ethenyl-5-methyl-1-[(4-methylphenyl)methyl]pyrrole-2-carboxylate (PubChem CID 156746181) has the molecular formula C18H20BrNO2 and a molecular weight of 362.27 g/mol. Its IUPAC name is ethyl 4-bromo-3-ethenyl-5-methyl-1-[(4-methylphenyl)methyl]pyrrole-2-carboxylate.
| Compound Name | ethyl 4-bromo-3-ethenyl-5-methyl-1-[(4-methylphenyl)methyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 156746181 |
| Molecular Formula | C18H20BrNO2 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | ethyl 4-bromo-3-ethenyl-5-methyl-1-[(4-methylphenyl)methyl]pyrrole-2-carboxylate |
| SMILES | C=Cc1c(Br)c(C)n(Cc2ccc(C)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C18H20BrNO2/c1-5-15-16(19)13(4)20(17(15)18(21)22-6-2)11-14-9-7-12(3)8-10-14/h5,7-10H,1,6,11H2,2-4H3 |
| InChIKey | VIYYBMSYLYUQIV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |