C16H23N5O3 — CID 156747512
2-amino-9-(5-propyloxolan-2-yl)-7-prop-2-ynyl-1H-purine-6,8-dione;methane (PubChem CID 156747512) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-amino-9-(5-propyloxolan-2-yl)-7-prop-2-ynyl-1H-purine-6,8-dione;methane.
| Compound Name | 2-amino-9-(5-propyloxolan-2-yl)-7-prop-2-ynyl-1H-purine-6,8-dione;methane |
|---|---|
| PubChem CID | 156747512 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-amino-9-(5-propyloxolan-2-yl)-7-prop-2-ynyl-1H-purine-6,8-dione;methane |
| SMILES | C.C#CCn1c(=O)n(C2CCC(CCC)O2)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C15H19N5O3.CH4/c1-3-5-9-6-7-10(23-9)20-12-11(13(21)18-14(16)17-12)19(8-4-2)15(20)22;/h2,9-10H,3,5-8H2,1H3,(H3,16,17,18,21);1H4 |
| InChIKey | JFIIPTXKRZWGLV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|