C14H17N5O3 — CID 156747521
2-amino-9-(5-ethyloxolan-2-yl)-7-prop-2-ynyl-1H-purine-6,8-dione (PubChem CID 156747521) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-amino-9-(5-ethyloxolan-2-yl)-7-prop-2-ynyl-1H-purine-6,8-dione.
| Compound Name | 2-amino-9-(5-ethyloxolan-2-yl)-7-prop-2-ynyl-1H-purine-6,8-dione |
|---|---|
| PubChem CID | 156747521 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-amino-9-(5-ethyloxolan-2-yl)-7-prop-2-ynyl-1H-purine-6,8-dione |
| SMILES | C#CCn1c(=O)n(C2CCC(CC)O2)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C14H17N5O3/c1-3-7-18-10-11(16-13(15)17-12(10)20)19(14(18)21)9-6-5-8(4-2)22-9/h1,8-9H,4-7H2,2H3,(H3,15,16,17,20) |
| InChIKey | WPEUPUBTNXJIOD-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|