C10H13N3 — CID 156748875
N-(imidazo[1,5-a]pyridin-1-ylmethyl)ethanamine (PubChem CID 156748875) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is N-(imidazo[1,5-a]pyridin-1-ylmethyl)ethanamine.
| Compound Name | N-(imidazo[1,5-a]pyridin-1-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 156748875 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N-(imidazo[1,5-a]pyridin-1-ylmethyl)ethanamine |
| SMILES | CCNCc1ncn2ccccc12 |
| InChI | InChI=1S/C10H13N3/c1-2-11-7-9-10-5-3-4-6-13(10)8-12-9/h3-6,8,11H,2,7H2,1H3 |
| InChIKey | LUAGGBDRBFAWHQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |