C12H15N3O — CID 142478784
N-butylimidazo[1,5-a]pyridine-1-carboxamide (PubChem CID 142478784) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is N-butylimidazo[1,5-a]pyridine-1-carboxamide.
| Compound Name | N-butylimidazo[1,5-a]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 142478784 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N-butylimidazo[1,5-a]pyridine-1-carboxamide |
| SMILES | CCCCNC(=O)c1ncn2ccccc12 |
| InChI | InChI=1S/C12H15N3O/c1-2-3-7-13-12(16)11-10-6-4-5-8-15(10)9-14-11/h4-6,8-9H,2-3,7H2,1H3,(H,13,16) |
| InChIKey | LWQFRCVYLWXCPH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|