C13H21F2NO — CID 156749583
3,3-difluoro-2-[(3Z)-5-methoxy-2-methylidenehexa-3,5-dienyl]piperidine;molecular hydrogen (PubChem CID 156749583) has the molecular formula C13H21F2NO and a molecular weight of 245.31 g/mol. Its IUPAC name is 3,3-difluoro-2-[(3Z)-5-methoxy-2-methylidenehexa-3,5-dienyl]piperidine;molecular hydrogen.
| Compound Name | 3,3-difluoro-2-[(3Z)-5-methoxy-2-methylidenehexa-3,5-dienyl]piperidine;molecular hydrogen |
|---|---|
| PubChem CID | 156749583 |
| Molecular Formula | C13H21F2NO |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 3,3-difluoro-2-[(3Z)-5-methoxy-2-methylidenehexa-3,5-dienyl]piperidine;molecular hydrogen |
| SMILES | C=C(/C=C\C(=C)OC)CC1NCCCC1(F)F.[H][H] |
| InChI | InChI=1S/C13H19F2NO.H2/c1-10(5-6-11(2)17-3)9-12-13(14,15)7-4-8-16-12;/h5-6,12,16H,1-2,4,7-9H2,3H3;1H/b6-5-; |
| InChIKey | TWNUPMVYPRNJCE-YSMBQZINSA-N |
| XLogP | 3.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|