C18H31F2NO — CID 123472113
N-[(2,6-difluoro-4-methoxycyclohexa-2,4-dien-1-yl)methyl]decan-4-amine (PubChem CID 123472113) has the molecular formula C18H31F2NO and a molecular weight of 315.45 g/mol. Its IUPAC name is N-[(2,6-difluoro-4-methoxycyclohexa-2,4-dien-1-yl)methyl]decan-4-amine.
| Compound Name | N-[(2,6-difluoro-4-methoxycyclohexa-2,4-dien-1-yl)methyl]decan-4-amine |
|---|---|
| PubChem CID | 123472113 |
| Molecular Formula | C18H31F2NO |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | N-[(2,6-difluoro-4-methoxycyclohexa-2,4-dien-1-yl)methyl]decan-4-amine |
| SMILES | CCCCCCC(CCC)NCC1C(F)=CC(OC)=CC1F |
| InChI | InChI=1S/C18H31F2NO/c1-4-6-7-8-10-14(9-5-2)21-13-16-17(19)11-15(22-3)12-18(16)20/h11-12,14,16-17,21H,4-10,13H2,1-3H3 |
| InChIKey | FHSWTNSSHSIYLS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|