C24H43NOSc-2 — CID 167514389
carbanide;2-ethyl-N-[3-(4-heptyl-3-methoxybenzene-6-id-1-yl)propyl]butan-1-amine;scandium (PubChem CID 167514389) has the molecular formula C24H43NOSc-2 and a molecular weight of 406.57 g/mol. Its IUPAC name is carbanide;2-ethyl-N-[3-(4-heptyl-3-methoxybenzene-6-id-1-yl)propyl]butan-1-amine;scandium.
| Compound Name | carbanide;2-ethyl-N-[3-(4-heptyl-3-methoxybenzene-6-id-1-yl)propyl]butan-1-amine;scandium |
|---|---|
| PubChem CID | 167514389 |
| Molecular Formula | C24H43NOSc-2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | carbanide;2-ethyl-N-[3-(4-heptyl-3-methoxybenzene-6-id-1-yl)propyl]butan-1-amine;scandium |
| SMILES | CCCCCCCc1c[c-]c(CCCNCC(CC)CC)cc1OC.[CH3-].[Sc] |
| InChI | InChI=1S/C23H40NO.CH3.Sc/c1-5-8-9-10-11-14-22-16-15-21(18-23(22)25-4)13-12-17-24-19-20(6-2)7-3;;/h16,18,20,24H,5-14,17,19H2,1-4H3;1H3;/q2*-1; |
| InChIKey | QKWZPEQMVFOHFE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|