C12H19NO — CID 156749674
2-[(3Z)-2-methylidenehexa-3,5-dienyl]piperidin-3-ol (PubChem CID 156749674) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-[(3Z)-2-methylidenehexa-3,5-dienyl]piperidin-3-ol.
| Compound Name | 2-[(3Z)-2-methylidenehexa-3,5-dienyl]piperidin-3-ol |
|---|---|
| PubChem CID | 156749674 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-[(3Z)-2-methylidenehexa-3,5-dienyl]piperidin-3-ol |
| SMILES | C=C/C=C\C(=C)CC1NCCCC1O |
| InChI | InChI=1S/C12H19NO/c1-3-4-6-10(2)9-11-12(14)7-5-8-13-11/h3-4,6,11-14H,1-2,5,7-9H2/b6-4- |
| InChIKey | KNLLRUYPRHRNEZ-XQRVVYSFSA-N |
| XLogP | 1.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|