C14H21ClN4O3 — CID 156750105
[(3R)-1-(5-chloro-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] carbamate;methylcyclobutane (PubChem CID 156750105) has the molecular formula C14H21ClN4O3 and a molecular weight of 328.80 g/mol. Its IUPAC name is [(3R)-1-(5-chloro-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] carbamate;methylcyclobutane.
| Compound Name | [(3R)-1-(5-chloro-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] carbamate;methylcyclobutane |
|---|---|
| PubChem CID | 156750105 |
| Molecular Formula | C14H21ClN4O3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [(3R)-1-(5-chloro-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] carbamate;methylcyclobutane |
| SMILES | CC1CCC1.NC(=O)O[C@@H]1CCN(c2cn[nH]c(=O)c2Cl)C1 |
| InChI | InChI=1S/C9H11ClN4O3.C5H10/c10-7-6(3-12-13-8(7)15)14-2-1-5(4-14)17-9(11)16;1-5-3-2-4-5/h3,5H,1-2,4H2,(H2,11,16)(H,13,15);5H,2-4H2,1H3/t5-;/m1./s1 |
| InChIKey | MYDJPCHEDLJNMV-NUBCRITNSA-N |
| XLogP | 1.90 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |