C20H41NO4Si — CID 156751745
tert-butyl 4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-4-methylpiperidine-1-carboxylate (PubChem CID 156751745) has the molecular formula C20H41NO4Si and a molecular weight of 387.64 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 156751745 |
| Molecular Formula | C20H41NO4Si |
| Molecular Weight | 387.64 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | tert-butyl 4-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-4-methylpiperidine-1-carboxylate |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)C(O)C1(C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H41NO4Si/c1-15(25-26(9,10)19(5,6)7)16(22)20(8)11-13-21(14-12-20)17(23)24-18(2,3)4/h15-16,22H,11-14H2,1-10H3/t15-,16?/m0/s1 |
| InChIKey | ZSMIAPAIQSZZMT-VYRBHSGPSA-N |
| XLogP | 4.79 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|