C40H52N2O8+2 — CID 156751802
4-O-[(4-benzyl-4-methylmorpholin-4-ium-2-yl)methyl] 1-O-[3-[6,7-dimethoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl] but-2-enedioate (PubChem CID 156751802) has the molecular formula C40H52N2O8+2 and a molecular weight of 688.86 g/mol. Its IUPAC name is 4-O-[(4-benzyl-4-methylmorpholin-4-ium-2-yl)methyl] 1-O-[3-[6,7-dimethoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl] but-2-enedioate.
| Compound Name | 4-O-[(4-benzyl-4-methylmorpholin-4-ium-2-yl)methyl] 1-O-[3-[6,7-dimethoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl] but-2-enedioate |
|---|---|
| PubChem CID | 156751802 |
| Molecular Formula | C40H52N2O8+2 |
| Molecular Weight | 688.86 g/mol |
| Exact Mass | 688.37 |
| IUPAC Name | 4-O-[(4-benzyl-4-methylmorpholin-4-ium-2-yl)methyl] 1-O-[3-[6,7-dimethoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]propyl] but-2-enedioate |
| SMILES | COc1ccc(CC2c3cc(OC)c(OC)cc3CC[N+]2(C)CCCOC(=O)C=CC(=O)OCC2C[N+](C)(Cc3ccccc3)CCO2)cc1 |
| InChI | InChI=1S/C40H52N2O8/c1-41(27-31-10-7-6-8-11-31)21-23-48-34(28-41)29-50-40(44)17-16-39(43)49-22-9-19-42(2)20-18-32-25-37(46-4)38(47-5)26-35(32)36(42)24-30-12-14-33(45-3)15-13-30/h6-8,10-17,25-26,34,36H,9,18-24,27-29H2,1-5H3/q+2 |
| InChIKey | WAXPIQWCSYUEAG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.86 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|