C24H33N3O — CID 156752452
3-(3-ethylphenyl)-N-[(2S)-1-(4-ethylpiperazin-1-yl)propan-2-yl]benzamide (PubChem CID 156752452) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 3-(3-ethylphenyl)-N-[(2S)-1-(4-ethylpiperazin-1-yl)propan-2-yl]benzamide.
| Compound Name | 3-(3-ethylphenyl)-N-[(2S)-1-(4-ethylpiperazin-1-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 156752452 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 3-(3-ethylphenyl)-N-[(2S)-1-(4-ethylpiperazin-1-yl)propan-2-yl]benzamide |
| SMILES | CCc1cccc(-c2cccc(C(=O)N[C@@H](C)CN3CCN(CC)CC3)c2)c1 |
| InChI | InChI=1S/C24H33N3O/c1-4-20-8-6-9-21(16-20)22-10-7-11-23(17-22)24(28)25-19(3)18-27-14-12-26(5-2)13-15-27/h6-11,16-17,19H,4-5,12-15,18H2,1-3H3,(H,25,28)/t19-/m0/s1 |
| InChIKey | WJJJKYJEYMUBOB-IBGZPJMESA-N |
| XLogP | 3.67 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |