C25H29N3O2 — CID 156753096
3-[[5-(2-cyclopropylethynyl)-3-pyridinyl]methylamino]-N-[(1S,2S)-2-hydroxycyclohexyl]-4-methylbenzamide (PubChem CID 156753096) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 3-[[5-(2-cyclopropylethynyl)-3-pyridinyl]methylamino]-N-[(1S,2S)-2-hydroxycyclohexyl]-4-methylbenzamide.
| Compound Name | 3-[[5-(2-cyclopropylethynyl)-3-pyridinyl]methylamino]-N-[(1S,2S)-2-hydroxycyclohexyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 156753096 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 3-[[5-(2-cyclopropylethynyl)-3-pyridinyl]methylamino]-N-[(1S,2S)-2-hydroxycyclohexyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@H]2CCCC[C@@H]2O)cc1NCc1cncc(C#CC2CC2)c1 |
| InChI | InChI=1S/C25H29N3O2/c1-17-6-11-21(25(30)28-22-4-2-3-5-24(22)29)13-23(17)27-16-20-12-19(14-26-15-20)10-9-18-7-8-18/h6,11-15,18,22,24,27,29H,2-5,7-8,16H2,1H3,(H,28,30)/t22-,24-/m0/s1 |
| InChIKey | OMJWAMMBTARMLW-UPVQGACJSA-N |
| XLogP | 3.80 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|