C23H27FN3NaO5 — CID 156753517
sodium;N-(4-fluoro-3-methylphenyl)-1,2,4-trimethyl-5-(2-oxoacetyl)pyrrole-3-carboxamide;2-pyrrolidin-1-ylacetic acid (PubChem CID 156753517) has the molecular formula C23H27FN3NaO5 and a molecular weight of 467.47 g/mol. Its IUPAC name is sodium;N-(4-fluoro-3-methylphenyl)-1,2,4-trimethyl-5-(2-oxoacetyl)pyrrole-3-carboxamide;2-pyrrolidin-1-ylacetic acid.
| Compound Name | sodium;N-(4-fluoro-3-methylphenyl)-1,2,4-trimethyl-5-(2-oxoacetyl)pyrrole-3-carboxamide;2-pyrrolidin-1-ylacetic acid |
|---|---|
| PubChem CID | 156753517 |
| Molecular Formula | C23H27FN3NaO5 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | sodium;N-(4-fluoro-3-methylphenyl)-1,2,4-trimethyl-5-(2-oxoacetyl)pyrrole-3-carboxamide;2-pyrrolidin-1-ylacetic acid |
| SMILES | Cc1cc(NC(=O)c2c(C)c(C(=O)[C-]=O)n(C)c2C)ccc1F.O=C(O)CN1CCCC1.[Na+] |
| InChI | InChI=1S/C17H16FN2O3.C6H11NO2.Na/c1-9-7-12(5-6-13(9)18)19-17(23)15-10(2)16(14(22)8-21)20(4)11(15)3;8-6(9)5-7-3-1-2-4-7;/h5-7H,1-4H3,(H,19,23);1-5H2,(H,8,9);/q-1;;+1 |
| InChIKey | FTTYVFATLOBZPT-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|