C17H27N — CID 156754055
N-butyl-3,3,7-trimethyl-2,4-dihydro-1H-naphthalen-1-amine (PubChem CID 156754055) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is N-butyl-3,3,7-trimethyl-2,4-dihydro-1H-naphthalen-1-amine.
| Compound Name | N-butyl-3,3,7-trimethyl-2,4-dihydro-1H-naphthalen-1-amine |
|---|---|
| PubChem CID | 156754055 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | N-butyl-3,3,7-trimethyl-2,4-dihydro-1H-naphthalen-1-amine |
| SMILES | CCCCNC1CC(C)(C)Cc2ccc(C)cc21 |
| InChI | InChI=1S/C17H27N/c1-5-6-9-18-16-12-17(3,4)11-14-8-7-13(2)10-15(14)16/h7-8,10,16,18H,5-6,9,11-12H2,1-4H3 |
| InChIKey | HCECQZWIHVQITR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|