C13H19N — CID 18331743
N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 18331743) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 18331743 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCNC1CCc2ccccc2C1 |
| InChI | InChI=1S/C13H19N/c1-2-9-14-13-8-7-11-5-3-4-6-12(11)10-13/h3-6,13-14H,2,7-10H2,1H3 |
| InChIKey | CHNZNFYUKYAHER-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |