C39H39N5O3S — CID 156755524
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[S-(4,6,7,8-tetrahydropyrazolo[5,1-c][1,4]oxazepin-3-yl)-N-tritylsulfonimidoyl]urea (PubChem CID 156755524) has the molecular formula C39H39N5O3S and a molecular weight of 657.84 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[S-(4,6,7,8-tetrahydropyrazolo[5,1-c][1,4]oxazepin-3-yl)-N-tritylsulfonimidoyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[S-(4,6,7,8-tetrahydropyrazolo[5,1-c][1,4]oxazepin-3-yl)-N-tritylsulfonimidoyl]urea |
|---|---|
| PubChem CID | 156755524 |
| Molecular Formula | C39H39N5O3S |
| Molecular Weight | 657.84 g/mol |
| Exact Mass | 657.28 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[S-(4,6,7,8-tetrahydropyrazolo[5,1-c][1,4]oxazepin-3-yl)-N-tritylsulfonimidoyl]urea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=NC(c1ccccc1)(c1ccccc1)c1ccccc1)c1cnn2c1COCCC2 |
| InChI | InChI=1S/C39H39N5O3S/c45-38(41-37-33-21-10-13-28(33)25-29-14-11-22-34(29)37)42-48(46,36-26-40-44-23-12-24-47-27-35(36)44)43-39(30-15-4-1-5-16-30,31-17-6-2-7-18-31)32-19-8-3-9-20-32/h1-9,15-20,25-26H,10-14,21-24,27H2,(H2,41,42,43,45,46) |
| InChIKey | XYEMRGDOOFKSKL-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.84 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|