C39H39N5O3S — CID 165370300
1-[S-(2,2-dimethyl-3H-pyrazolo[5,1-b][1,3]oxazol-7-yl)-N-tritylsulfonimidoyl]-3-[(4S)-4-methyl-2-tricyclo[6.3.0.03,6]undeca-1,3(6),7-trienyl]urea (PubChem CID 165370300) has the molecular formula C39H39N5O3S and a molecular weight of 657.84 g/mol. Its IUPAC name is 1-[S-(2,2-dimethyl-3H-pyrazolo[5,1-b][1,3]oxazol-7-yl)-N-tritylsulfonimidoyl]-3-[(4S)-4-methyl-2-tricyclo[6.3.0.03,6]undeca-1,3(6),7-trienyl]urea.
| Compound Name | 1-[S-(2,2-dimethyl-3H-pyrazolo[5,1-b][1,3]oxazol-7-yl)-N-tritylsulfonimidoyl]-3-[(4S)-4-methyl-2-tricyclo[6.3.0.03,6]undeca-1,3(6),7-trienyl]urea |
|---|---|
| PubChem CID | 165370300 |
| Molecular Formula | C39H39N5O3S |
| Molecular Weight | 657.84 g/mol |
| Exact Mass | 657.28 |
| IUPAC Name | 1-[S-(2,2-dimethyl-3H-pyrazolo[5,1-b][1,3]oxazol-7-yl)-N-tritylsulfonimidoyl]-3-[(4S)-4-methyl-2-tricyclo[6.3.0.03,6]undeca-1,3(6),7-trienyl]urea |
| SMILES | C[C@H]1Cc2cc3c(c(NC(=O)NS(=O)(=NC(c4ccccc4)(c4ccccc4)c4ccccc4)c4cnn5c4OC(C)(C)C5)c21)CCC3 |
| InChI | InChI=1S/C39H39N5O3S/c1-26-22-28-23-27-14-13-21-32(27)35(34(26)28)41-37(45)42-48(46,33-24-40-44-25-38(2,3)47-36(33)44)43-39(29-15-7-4-8-16-29,30-17-9-5-10-18-30)31-19-11-6-12-20-31/h4-12,15-20,23-24,26H,13-14,21-22,25H2,1-3H3,(H2,41,42,43,45,46)/t26-,48?/m0/s1 |
| InChIKey | HMOYLNWZVBKNFH-KSOVPSILSA-N |
| XLogP | 7.76 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.84 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|